Gitingest

Include files under: 50kB

Private Repository NEW

Summary

Repository: vishalsingh17/pythonbigdataquestions
Files analyzed: 3

Estimated tokens: 9.8k

Download

Directory Structure

Directory structure:

└── vishalsingh17-pythonbigdataquestions/

    ├── Python_OOP_Assignment.md

    ├── PythonAssignment.md

    └── PythonAssignmentSolution.md

Files Content

================================================
FILE: Python_OOP_Assignment.md
================================================
## Python OOP Assignment
Q1. What is the purpose of Python's OOP?

Q2. Where does an inheritance search look for an attribute?

Q3. How do you distinguish between a class object and an instance object?

Q4. What makes the first argument in a class’s method function special?

Q5. What is the purpose of the init method?

Q6. What is the process for creating a class instance?

Q7. What is the process for creating a class?

Q8. How would you define the superclasses of a class?

Q9. What is the relationship between classes and modules?

Q10. How do you make instances and classes?

Q11. Where and how should be class attributes created?

Q12. Where and how are instance attributes created?

Q13. What does the term "self" in a Python class mean?

Q14. How does a Python class handle operator overloading?

Q15. When do you consider allowing operator overloading of your classes?

Q16. What is the most popular form of operator overloading?

Q17. What are the two most important concepts to grasp in order to comprehend Python OOP code?

Q18. Describe three applications for exception processing.

Q19. What happens if you don't do something extra to treat an exception?

Q20. What are your options for recovering from an exception in your script?

Q21. Describe two methods for triggering exceptions in your script.

Q22. Identify two methods for specifying actions to be executed at termination time, regardless of  
whether or not an exception exists.

Q23. What is the purpose of the try statement?

Q24. What are the two most popular try statement variations?

Q25. What is the purpose of the raise statement?

Q26. What does the assert statement do, and what other statement is it like?

Q27. What is the purpose of the with/as argument, and what other statement is it like?

Q28. What are *args, **kwargs?

Q29. How can I pass optional or keyword parameters from one function to another?

Q30. What are Lambda Functions?

Q31. Explain Inheritance in Python with an example?

Q32. Suppose class C inherits from classes A and B as class C(A,B).Classes A and B both have their own versions of method func(). If we call func() from an object of 
class C, which version gets invoked?

Q33. Which methods/functions do we use to determine the type of instance and inheritance?

Q34.Explain the use of the 'nonlocal' keyword in Python.

Q35. What is the global keyword?



================================================
FILE: PythonAssignment.md
================================================
## Assignment Part-1
Q1. Why do we call Python as a general purpose and high-level programming language?

Q2. Why is Python called a dynamically typed language?

Q3. List some pros and cons of Python programming language?

Q4. In what all domains can we use Python?

Q5. What are variable and how can we declare them?

Q6. How can we take an input from the user in Python?

Q7. What is the default datatype of the value that has been taken as an input using input() function?

Q8. What is type casting?

Q9. Can we take more than one input from the user using single input() function? If yes, how? If no, why?

Q10. What are keywords?

Q11. Can we use keywords as a variable? Support your answer with reason.

Q12. What is indentation? What's the use of indentaion in Python?

Q13. How can we throw some output in Python?

Q14. What are operators in Python?

Q15. What is difference between / and // operators?

Q16. Write a code that gives following as an output.
```
iNeuroniNeuroniNeuroniNeuron
```

Q17. Write a code to take a number as an input from the user and check if the number is odd or even.

Q18. What are boolean operator?

Q19. What will the output of the following?
```
1 or 0

0 and 0

True and False and True

1 or 0 or 0
```

Q20. What are conditional statements in Python?

Q21. What is use of 'if', 'elif' and 'else' keywords?

Q22. Write a code to take the age of person as an input and if age >= 18 display "I can vote". If age is < 18 display "I can't vote".

Q23. Write a code that displays the sum of all the even numbers from the given list.
```
numbers = [12, 75, 150, 180, 145, 525, 50]
```


Q24. Write a code to take 3 numbers as an input from the user and display the greatest no as output.

Q25. Write a program to display only those numbers from a list that satisfy the following conditions

- The number must be divisible by five

- If the number is greater than 150, then skip it and move to the next number

- If the number is greater than 500, then stop the loop
```
numbers = [12, 75, 150, 180, 145, 525, 50]
```

Q26. What is a string? How can we declare string in Python?

Q27. How can we access the string using its index?

Q28. Write a code to get the desired output of the following
```
string = "Big Data iNeuron"
desired_output = "iNeuron"
```

Q29. Write a code to get the desired output of the following
```
string = "Big Data iNeuron"
desired_output = "norueNi"
```

Q30. Resverse the string given in the above question.

Q31. How can you delete entire string at once?

Q32. What is escape sequence?

Q33. How can you print the below string?
```
'iNeuron's Big Data Course'
```

Q34. What is a list in Python?

Q35. How can you create a list in Python?

Q36. How can we access the elements in a list?

Q37. Write a code to access the word "iNeuron" from the given list.
```
lst = [1,2,3,"Hi",[45,54, "iNeuron"], "Big Data"]
``` 

Q38. Take a list as an input from the user and find the length of the list.

Q39. Add the word "Big" in the 3rd index of the given list.
```
lst = ["Welcome", "to", "Data", "course"]
```

Q40. What is a tuple? How is it different from list?

Q41. How can you create a tuple in Python?

Q42. Create a tuple and try to add your name in the tuple. Are you able to do it? Support your answer with reason.

Q43. Can two tuple be appended. If yes, write a code for it. If not, why?

Q44. Take a tuple as an input and print the count of elements in it.

Q45. What are sets in Python?

Q46. How can you create a set?

Q47. Create a set and add "iNeuron" in your set.

Q48. Try to add multiple values using add() function.

Q49. How is update() different from add()?

Q50. What is clear() in sets?

Q51. What is frozen set?

Q52. How is frozen set different from set?

Q53. What is union() in sets? Explain via code.

Q54. What is intersection() in sets? Explain via code.

Q55. What is dictionary ibn Python?

Q56. How is dictionary different from all other data structures.

Q57. How can we delare a dictionary in Python?

Q58. What will the output of the following?
```
var = {}
print(type(var))
```

Q59. How can we add an element in a dictionary?

Q60. Create a dictionary and access all the values in that dictionary.

Q61. Create a nested dictionary and access all the element in the inner dictionary.

Q62. What is the use of get() function?

Q63. What is the use of items() function?

Q64. What is the use of pop() function?

Q65. What is the use of popitems() function?

Q66. What is the use of keys() function?

Q67. What is the use of values() function?

Q68. What are loops in Python?

Q69. How many type of loop are there in Python?

Q70. What is the difference between for and while loops?

Q71. What is the use of continue statement?

Q72. What is the use of break statement?

Q73. What is the use of pass statement?

Q74. What is the use of range() function?

Q75. How can you loop over a dictionary?


### Coding problems
Q76. Write a Python program to find the factorial of a given number.

Q77. Write a Python program to calculate the simple interest. Formula to calculate simple interest is SI = (P*R*T)/100

Q78. Write a Python program to calculate the compound interest. Formula of compound interest is A = P(1+ R/100)^t.

Q79. Write a Python program to check if a number is prime or not.

Q80. Write a Python program to check Armstrong Number.

Q81. Write a Python program to find the n-th Fibonacci Number.

Q82. Write a Python program to interchange the first and last element in a list.

Q83. Write a Python program to swap two elements in a list.

Q84. Write a Python program to find N largest element from a list.

Q85. Write a Python program to find cumulative sum of a list.

Q86. Write a Python program to check if a string is palindrome or not.

Q87. Write a Python program to remove i'th element from a string.

Q88. Write a Python program to check if a substring is present in a given string.

Q89. Write a Python program to find words which are greater than given length k.

Q90. Write a Python program to extract unquire dictionary values.

Q91. Write a Python program to merge two dictionary.

Q92. Write a Python program to convert a list of tuples into dictionary.
```
Input : [('Sachin', 10), ('MSD', 7), ('Kohli', 18), ('Rohit', 45)]
Output : {'Sachin': 10, 'MSD': 7, 'Kohli': 18, 'Rohit': 45}
```

Q93. Write a Python program to create a list of tuples from given list having number and its cube in each tuple.
```
Input: list = [9, 5, 6]
Output: [(9, 729), (5, 125), (6, 216)]
```

Q94. Write a Python program to get all combinations of 2 tuples.
```
Input : test_tuple1 = (7, 2), test_tuple2 = (7, 8)
Output : [(7, 7), (7, 8), (2, 7), (2, 8), (7, 7), (7, 2), (8, 7), (8, 2)]
```

Q95. Write a Python program to sort a list of tuples by second item.
```
Input : [('for', 24), ('Geeks', 8), ('Geeks', 30)] 
Output : [('Geeks', 8), ('for', 24), ('Geeks', 30)]
```

Q96. Write a python program to print below pattern.
```
* 
* * 
* * * 
* * * * 
* * * * * 
```
Q97. Write a python program to print below pattern.
```
    *
   **
  ***
 ****
*****
```

Q98. Write a python program to print below pattern.
```
    * 
   * * 
  * * * 
 * * * * 
* * * * * 
```

Q99. Write a python program to print below pattern.
```
1 
1 2 
1 2 3 
1 2 3 4 
1 2 3 4 5
```

Q100. Write a python program to print below pattern.
```
A 
B B 
C C C 
D D D D 
E E E E E 
```


================================================
FILE: PythonAssignmentSolution.md
================================================
## Assignment Part-1
Q1. Why do we call Python as a general purpose and high-level programming language?
Ans1. Python is called general purpose because it can used to design and develop a wide variety of applications, across multiple domain. High-level programming language means it's more user-friendly. Coding in Python is like writing a story in English.

Q2. Why is Python called a dynamically typed language?
Ans2. Dynamically typed language means that variables are checked against types only when the program is executing. We don't need to declare the variable type, the interpreter automatically interprets it.

Q3. List some pros and cons of Python programming language?

Ans3. 
Pros:
  - Easy to use
  - Easy to integrate
  - Multi-paradigm approach
  - High library support

  Cons:
  - Slow speed of execution compared to C,C++
  - Absence from mobile computing and browsers

Q4. In what all domains can we use Python?

Ans4. 
- Graphic design, image processing applications, Games, and Scientific/ computational Applications
- Web frameworks and applications 
- Database Access
- Language Development 
- Prototyping 
- Software Development
- Data Science and Machine Learning
- Scripting

Q5. What are variable and how can we declare them?

Ans5. A variable is a symbolic name that is a reference or pointer to an object. Once an object is assigned to a variable, you can refer to the object by that name.
```python
var = 17
```

Q6. How can we take an input from the user in Python?

Ans6. By using input() function.

Q7. What is the default datatype of the value that has been taken as an input using input() function?
Ans7. string

Q8. What is type casting?

Ans8. Type casting means changing the datatype of the variable. We can only type casting the datatype having higher bit value to the lower bit value.

Q9. Can we take more than one input from the user using single input() function? If yes, how? If no, why?

Ans9. Yes.
```python
x, y, z = input("Enter three values: ").split(",")
print("Total number of students: ", x)
print("Number of boys is : ", y)
print("Number of girls is : ", z)
print()
```
```python
x = [int(x) for x in input("Enter multiple value: ").split(",")]
print("Number of list is: ", x) 
```
Q10. What are keywords?

Ans10. Keywords in Python are reserved words that can not be used as a variable name, function name, or any other identifier.

Q11. Can we use keywords as a variable? Support your answer with reason.

Ans11. Yes we can but we shoudn't as it will override the properties of the keyword.

Q12. What is indentation? What's the use of indentaion in Python?

Ans12. Indentation is the whitespace used in Python. Indentation is used to create block of statement.

Q13. How can we throw some output in Python?

Ans13. Using print() function.

Q14. What are operators in Python?

Ans14. Symbols or keywords used to perform certain operations on values or variable are known as operators. There are different types of operators like
- Arithmetic operators
- Comparison Operators
- Logical Operators
- Bitwise Operators
- Assignment Operators 


Q15. What is difference between / and // operators?

Ans15. / is used for float division and // is used of floor (integer) division.

Q16. Write a code that gives following as an output.
```
iNeuroniNeuroniNeuroniNeuron
```
Ans16. 
```python
"iNeuron"*3
```

Q17. Write a code to take a number as an input from the user and check if the number is odd or even.
Ans17.
```python
num = float(input("Enter a number: "))
if num%2 == 0:
  print(f"{num} is even")
else:
  print(f"{num} is odd")
```

Q18. What are boolean operator?
Ans18. True , False , not , and , or are the only built-in Python Boolean operators.

Q19. What will the output of the following?
```python
1 or 0

0 and 0

True and False and True

1 or 0 or 0
```
Ans.19 Output of the following code will be
```python
1 or 0 -> 1
0 and 0 -> 0
True and False and True -> False
1 or 0 or 0 -> 1
```

Q20. What are conditional statements in Python?

Ans20. In large projects we have to control the flow of execution of our program and we want to execute some set of statements only if the given condition is satisfied, and a different set of statements when it’s not satisfied.


Q21. What is use of 'if', 'elif' and 'else' keywords?

Ans21. if is the first condition check for the condition.

if "if" is False then elif's condition is checked.

else is checked when all the upper condition fails.


Q22. Write a code to take the age of person as an input and if age >= 18 display "I can vote". If age is < 18 display "I can't vote".
Ans22. 
```python
age = int(input("Enter you age: "))
if age >= 18:
    print("I can vote")
else:
    print("I can't vote") 
```

Q23. Write a code that displays the sum of all the even numbers from the given list.
```python
numbers = [12, 75, 150, 180, 145, 525, 50]
```
Ans23. 
```python
numbers = [12, 75, 150, 180, 145, 525, 50]
add = 0
for num in numbers:
  if num%2 == 0:
    add = add+num
  else:
    continue
print(add) 
```

Q24. Write a code to take 3 numbers as an input from the user and display the greatest no as output.
Ans24.
```python
x, y, z = input("Enter 3 numbers seprated by comma: ").split(",")
if int(x) > int(y) and int(x) > int(z):
  print(f"{x} is greatest")
elif int(y) > int(z):
  print(f"{y} is greatest")
else:
  print(f"{z} is greatest")

```



Q25. Write a program to display only those numbers from a list that satisfy the following conditions

- The number must be divisible by five

- If the number is greater than 150, then skip it and move to the next number

- If the number is greater than 500, then stop the loop
```
numbers = [12, 75, 150, 180, 145, 525, 50]
```
Ans25. 
```python
numbers = [12, 75, 150, 180, 145, 525, 50]
lst = []
for num in numbers:
  if num > 150:
    if num > 500:
      break
  elif num%5==0:
    lst.append(num) 

print(lst)

```
Q26. What is a string? How can we declare string in Python?

Ans26. In Python, Strings are arrays of bytes representing Unicode characters.

Q27. How can we access the string using its index?

Ans27. Sqaure brackets can used to access the elements of the string.

Q28. Write a code to get the desired output of the following
```
string = "Big Data iNeuron"
desired_output = "iNeuron"
```
Ans28. 
```python
string[9:16]
```
Q29. Write a code to get the desired output of the following
```
string = "Big Data iNeuron"
desired_output = "norueNi"
```
Ans29. 
```python
string[15:8:-1]
```

Q30. Resverse the string given in the above question.
Ans30. 
```python
string[::-1]
```

Q31. How can you delete entire string at once?

Ans31. We can delete the entire string at once by using del keyword.
```python
str1 = "Hello"
del(str1)
```

Q32. What is escape sequence?

Ans32. The "backslash (\)" character as an escape character. In other words, it has a special meaning when we use it inside the strings. As the name suggests, the escape character escapes the characters in a string for a brief moment to introduce unique inclusion.

Q33. How can you print the below string?
```
'iNeuron's Big Data Course'
```
Ans33. 'iNeuron\'s Big Data Course'

Q34. What is a list in Python?

Ans34. Python list are dynamically sized array, declared in languages like C++ and Java. A list is a collection of things, enclosed in [ ] and separated by commas. 

Q35. How can you create a list in Python?

Ans35. You can create a list by opening and closing the square brackets.

Q36. How can we access the elements in a list?

Ans36. We can access the elements in a list by indexing.

Q37. Write a code to access the word "iNeuron" from the given list.
```
lst = [1,2,3,"Hi",[45,54, "iNeuron"], "Big Data"]
``` 
Ans37.
```python
lst = [1,2,3,"Hi",[45,54, "iNeuron"], "Big Data"]
lst[4][2]
```
Q38. Take a list as an input from the user and find the length of the list.

Ans38. 
```python
n = input("Enter number of elements seprated by space: ").split(" ")
print(len(n))
```

Q39. Add the word "Big" in the 3rd index of the given list.
```
lst = ["Welcome", "to", "Data", "course"]
```
Ans39. 
```python
lst = ["Welcome", "to", "Data", "course"]
lst.insert(2, "Big")
```

Q40. What is a tuple? How is it different from list?

Ans40. Tuple is a collection of Python objects much like a list. The sequence of values stored in a tuple can be of any type, and they are indexed by integers. 
Tuples are immutable where as list are mutable. We can also faster through the tuples than the list.

Q41. How can you create a tuple in Python?

Ans41. We can create tuple using round brackets ().

Q42. Create a tuple and try to add your name in the tuple. Are you able to do it? Support your answer with reason.

Ans42. No, I can't as tuples are immutable. The work around is it typecast tuple to list and then append.
```python
tup = ()
tup = list(tup)
tup.append("Vishal")
tup = tuple(tup)
tup
```

Q43. Can two tuple be appended. If yes, write a code for it. If not, why?

Ans43.Yes, we can.
```python
tup1 = ("Vishal ")
tup2 = ("Singh")
tup1+tup2
```

Q44. Take a tuple as an input and print the count of elements in it.

Ans44. 
```python
x = input("Enter the values separeted by space: ").split(" ")
x = tuple(x)
print(len(x))
```

Q45. What are sets in Python?

Ans45. A set is an unordered collection of data types that is iterable, mutable and has no duplicate elements. The order of elements in a set is undefined though it may consist of various elements.

Q46. How can you create a set?

Ans46. We can create set using curly brackets {}. Keep in mind empty {} will result in dictionary hence there must be some value in the brackets.

Q47. Create a set and add "iNeuron" in your set.

Ans47. 
```python
set1 = {"iNeuron"}
set1
```

Q48. Try to add multiple values using add() function.

Ans48. 
```python
set1.add("Big")
set1.add("Data")
set1
```

Q49. How is update() different from add()?

Ans49. We can add more than one element in a single go using update(), but using add() it's not possible.

Q50. What is clear() in sets?

Ans50. To remove all the elements from the set, clear() function is used.

Q51. What is frozen set?

Ans51. Frozen sets in Python are immutable objects that only support methods and operators that produce a result without affecting the frozen set or sets to which they are applied. While elements of a set can be modified at any time, elements of the frozen set remain the same after creation. 

Q52. How is frozen set different from set?

Ans52.
- Frozen sets are immutable where as sets are mutable.
- Sets can't be used as keys in dictionary where as frozen sets can be used.

Q53. What is union() in sets? Explain via code.


Ans53. Python set Union() Method returns a new set which contains all the items from the original set.
```python
set1 = {2, 4, 5, 6}
set2 = {4, 6, 7, 8}
set3 = {7, 8, 9, 10}

print("set1 U set2 : ", set1 | set2)

print("set1 U set2 U set3 :", set1 |set2 | set3)
```

Q54. What is intersection() in sets? Explain via code.

Ans54. Python set intersection() method returns a new set with an element that is common to all set
```python
set1 = {2, 4, 5, 6}
set2 = {4, 6, 7, 8}
set3 = {4, 6, 8}

print("set1 intersection set2 : ", set1.intersection(set2))

print("set1 intersection set2 intersection set3 :", set1.intersection(set2, set3))
```

Q55. What is dictionary ibn Python?

Ans55. Dictionary in Python is a collection of keys values, used to store data values like a map, which, unlike other data types which hold only a single value as an element.

Q56. How is dictionary different from all other data structures.

Ans56. Dictionary is having key and value pair where as all other data structures have only values in them.

Q57. How can we delare a dictionary in Python?

Ans57. We can create dictionary using curly brackets {}.

Q58. What will the output of the following?
```
var = {}
print(type(var))
```
Ans58. dict

Q59. How can we add an element in a dictionary?

Ans59. 
```python
Dict = {}
Dict[0] = "Hello"
Dict[1] = "Course: ["Data Science", "Big Data"]"
```

Q60. Create a dictionary and access all the values in that dictionary.

Ans60. 
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
for i, j in Dict.items():
  print(f"Key is {i} and value is {j}")
```

Q61. Create a nested dictionary and access all the element in the inner dictionary.

Ans61.
```python
Dict = {"Name": {"f_name":"Vishal", "l_name":"Singh"}, "Experience": 3, "Organisation":"iNeuron"}
for i, j in Dict["Name"].items():
  print(f"Key is {i} and value is {j}")
```
Q62. What is the use of get() function?

Ans62. get() is also to access the elements in dictionary.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.get("Name"))
```
Q63. What is the use of items() function?

Ans63. items() method is used to return the list with all dictionary keys with values.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.items())
```
Q64. What is the use of pop() function?

Ans64.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.pop("Name"))
```
Q65. What is the use of popitems() function?

Ans65. popitem() method removes the last inserted key-value pair from the dictionary and returns it as a tuple.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.popitem())
```
Q66. What is the use of keys() function?

Ans66.  keys() method returns a view object that displays a list of all the keys in the dictionary.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.keys())
```
Q67. What is the use of values() function?


Ans67. values() is an inbuilt method in Python programming language that returns a view object. The view object contains the values of the dictionary, as a list.
```python
Dict = {"Name": "Vishal", "Experience": 3, "Organisation":"iNeuron"}
print(Dict.values())
```

Q68. What are loops in Python?

Ans68. Loops are used the iterate over a block of statement multiple times.

Q69. How many type of loop are there in Python?

Ans69. There is for and while loop in Python

Q70. What is the difference between for and while loops?

Ans70. When we know the exact number of iterations, we can use for loop. When we want the to run till a certain condition is true we can use while loop.

Q71. What is the use of continue statement?

Ans71. Continue Statement skips the execution of the program block from after the continue statement and forces the control to start the next iteration.

Q72. What is the use of break statement?

Ans72. break statement in Python is used to bring the control out of the loop when some external condition is triggered. break statement is put inside the loop body

Q73. What is the use of pass statement?

Ans73. The pass statement is a null statement. But the difference between pass and comment is that comment is ignored by the interpreter whereas pass is not ignored. 

Q74. What is the use of range() function?

Ans74. range() function returns a sequence of numbers, in a given range. The most common use of it is to iterate sequence on a sequence of numbers

Q75. How can you loop over a dictionary?

Ans75. 
```python
statesAndCapitals = {
	'Gujarat': 'Gandhinagar',
	'Maharashtra': 'Mumbai',
	'Rajasthan': 'Jaipur',
	'Bihar': 'Patna'
}

for state in statesAndCapitals:
	print(state)
```

### Coding problems
Q76. Write a Python program to find the factorial of a given number.

Ans76.
```python
def factorial(n):
  if n < 0:
    return 0
  elif n == 0 or n == 1:
    return 1
  else:
    fact = 1
    while(n>1):
      fact *= n
      n -= 1
    return fact

n=6
print(f"Factorial of {n} is {factorial(n)}")
```
Q77. Write a Python program to calculate the simple interest. Formula to calculate simple interest is SI = (P*R*T)/100

Ans77.
```python
def SI(p,r,t):
  si = (p*r*t)/100
  print(f"Simple interest is {si}")
  return si

SI(8, 8, 6)
```      
Q78. Write a Python program to calculate the compound interest. Formula of compound interest is A = P(1+ R/100)^t.

Ans78.
```python
def CI(p, r, t):
  amount = p*(1+r/100)**t
  ci = amount - p
  print(f"Compound intrest is {ci}")
  return ci

CI(10000, 10.25, 5)
```
Q79. Write a Python program to check if a number is prime or not.

Ans79.
```python
from math import sqrt

def is_prime(n):
  prime_flag = 0

  if(n > 1):
    for i in range(2, int(sqrt(n)) + 1):
      if (n % i == 0):
        prime_flag = 1
        break
    if (prime_flag == 0):
      print(f"{n} is a prime number.")
    else:
      print(f"{n} is not a prime number.")
  else:
    print(f"{n} is not a prime number.")

is_prime(134)
```
Q80. Write a Python program to check Armstrong Number.

Ans80.
```python
def check_armstrong(n):
  s = n
  b = len(str(n))
  sum1 = 0
  while n != 0:
      r = n % 10
      sum1 = sum1+(r**b)
      n = n//10
  if s == sum1:
      print(f"The given number {s} is armstrong number")
  else:
      print(f"The given number {s} is not armstrong number")

check_armstrong(153)
```
Q81. Write a Python program to find the n-th Fibonacci Number.

Ans81.
```python
def Fibonacci(n):
	if n<= 0:
		print("Incorrect input")
	elif n == 1:
		return 0
	elif n == 2:
		return 1
	else:
		return Fibonacci(n-1)+Fibonacci(n-2)

print(Fibonacci(7))
```
Q82. Write a Python program to interchange the first and last element in a list.

Ans82.
```python
def swap_list(newList):
	size = len(newList)
	temp = newList[0]
	newList[0] = newList[size - 1]
	newList[size - 1] = temp
	
	return newList

newList = [15, 12, 35, 17, 9, 56, 29]

print(swap_list(newList))
```
```python
def swap_list(newList):
     
    newList[0], newList[-1] = newList[-1], newList[0]
 
    return newList
     
newList = [15, 12, 35, 17, 9, 56, 29]
print(swap_list(newList))
```
Q83. Write a Python program to swap two elements in a list.

Ans83.
```python
def swapPositions(list, pos1, pos2):
	
	list[pos1], list[pos2] = list[pos2], list[pos1]
	return list

List = [15, 12, 35, 17, 9, 56, 29]
pos1, pos2 = 1, 3

print(f"Original list: {List}")
print(f"Swapped list: {swapPositions(List, pos1, pos2)}")
```
Q84. Write a Python program to find N largest element from a list.

Ans84.
```python
def n_max_elements(list1, N):
	final_list = []

	for i in range(0, N):
		max1 = 0
		
		for j in range(len(list1)):	
			if list1[j] > max1:
				max1 = list1[j];
				
		list1.remove(max1);
		final_list.append(max1)
		
	print(final_list)

list1 = [2, 6, 41, 85, 0, 3, 7, 6, 10]
N = 3

n_max_elements(list1, N)
```
Q85. Write a Python program to find cumulative sum of a list.

Ans85.
```python
def cumulative_sum(lists):
	cu_list = []
	length = len(lists)
	cu_list = [sum(lists[0:x:1]) for x in range(0, length+1)]
	return cu_list[1:]

lists = [10, 20, 30, 40, 50]
print(f"Cumulative sum of the list is {cumulative_sum(lists)}")
```
Q86. Write a Python program to check if a string is palindrome or not.

Ans86.
```python
def isPalindrome(s):
  if s == s[::-1]:
	  return f"{s} is palindrome"
  return f"{s} is not palindrome"

s = "dad"
isPalindrome(s)
```
Q87. Write a Python program to remove i'th element from a string.

Ans87.
```python
def remove_ith_element(i):
  str1 = "Big Data Bootcamp"
  str2 = ""

  for n in range(len(str1)):
    if n == i:
      continue
    else:
      str2 = str2 + str1[n]

  return str2

remove_ith_element(5)
```
Q88. Write a Python program to check if a substring is present in a given string.

Ans88.
```python
def check_substring(s2, s1):
	if (s2.count(s1) > 0):
		print(f'"{s1}" is a substring of "{s2}"')
	else:
		print(f'"{s1}" is not a substring of "{s2}"')


s2 = "Welcome to iNeuron Big Data Bootcamp"
s1 = "iNeuron"
check_substring(s2, s1)
```
Q89. Write a Python program to find words which are greater than given length k.

Ans89.
```python
def string_greater_than_k(k, str):
	
	string = []

	text = str.split(" ")

	for x in text:

		if len(x) > k:

			string.append(x)

	return string

k = 3
str ="Big Data Bootcamp"
print(string_greater_than_k(k, str))
```
Q90. Write a Python program to extract unquire dictionary values.

Ans90.
```python
test_dict = {'iNeuron': [5, 6, 7, 8],
			'is': [10, 11, 7, 5],
			'best': [6, 12, 10, 8],
			'for': [1, 2, 5],
      'big data': [2, 7, 12, 9]
      }

print("The original dictionary is : " + str(test_dict))

res = list(sorted({ele for val in test_dict.values() for ele in val}))

print("The unique values list is : " + str(res))
```
Q91. Write a Python program to merge two dictionary.

Ans91.
```python
def Merge(dict1, dict2):
	return(dict2.update(dict1))

dict1 = {'a': 10, 'b': 8}
dict2 = {'d': 6, 'c': 4}

print(Merge(dict1, dict2))

print(dict2)

```
Q92. Write a Python program to convert a list of tuples into dictionary.
```python
Input : [('Sachin', 10), ('MSD', 7), ('Kohli', 18), ('Rohit', 45)]
Output : {'Sachin': 10, 'MSD': 7, 'Kohli': 18, 'Rohit': 45}
```
Ans92.
```python
print (dict([('Sachin', 10), ('MSD', 7), ('Kohli', 18), ('Rohit', 45)]))
```

Q93. Write a Python program to create a list of tuples from given list having number and its cube in each tuple.
```python
Input: list = [9, 5, 6]
Output: [(9, 729), (5, 125), (6, 216)]
```
Ans93.
```python

list1 = [9, 5, 6]

res = [(val, pow(val, 3)) for val in list1]

print(res)

```
Q94. Write a Python program to get all combinations of 2 tuples.
```python
Input : test_tuple1 = (7, 2), test_tuple2 = (7, 8)
Output : [(7, 7), (7, 8), (2, 7), (2, 8), (7, 7), (7, 2), (8, 7), (8, 2)]
```
Ans94.
```python
test_tuple1 = (7, 2)
test_tuple2 = (7, 8)

res = [(a, b) for a in test_tuple1 for b in test_tuple2]
res = res + [(a, b) for a in test_tuple2 for b in test_tuple1]

print("The filtered tuple : ", str(res))
```
Q95. Write a Python program to sort a list of tuples by second item.
```python
Input : [('452', 10), ('256', 5), ('100', 20), ('135', 15)]
Output : [('256', 5), ('452', 10), ('135', 15), ('100', 20)]
```
Ans95.
```python
def Sort_Tuple(tup):
     
    lst = len(tup)
    for i in range(0, lst):
         
        for j in range(0, lst-i-1):
            if (tup[j][1] > tup[j + 1][1]):
                temp = tup[j]
                tup[j]= tup[j + 1]
                tup[j + 1]= temp
    return tup
 
tup =[('452', 10), ('256', 5), ('100', 20), ('135', 15)]
       
print(Sort_Tuple(tup))
```
Q96. Write a python program to print below pattern.
```
* 
* * 
* * * 
* * * * 
* * * * * 
```
Ans96.
```python
def pypart(n):
	
	for i in range(0, n):
	
		for j in range(0, i+1):
		
			print("* ",end="")
	
		print("\r")

n = 5
pypart(n)

```
Q97. Write a python program to print below pattern.
```
    *
   **
  ***
 ****
*****
```
Ans97.
```python
def inverse_pattern():
  n=5;i=0
  while(i<=n):
    print(" " * (n - i) +"*" * i)
    i+=1

inverse_pattern()
```
Q98. Write a python program to print below pattern.
```
    * 
   * * 
  * * * 
 * * * * 
* * * * * 
```
Ans98.
```python

def triangle(n):
	
	k = n - 1

	for i in range(0, n):

		for j in range(0, k):
			print(end=" ")
	
		k = k - 1
	
		for j in range(0, i+1):

			print("* ", end="")
	
		print("\r")

n = 5
triangle(n)

```
Q99. Write a python program to print below pattern.
```
1 
1 2 
1 2 3 
1 2 3 4 
1 2 3 4 5
```
Ans99.
```python

def numpat(n):

	num = 1

	for i in range(0, n):

		num = 1

		for j in range(0, i+1):

			print(num, end=" ")

			num = num + 1

		print("\r")

n = 5
numpat(n)

```
Q100. Write a python program to print below pattern.
```
A 
B B 
C C C 
D D D D 
E E E E E 
```
Ans100.
```python

def alphapat(n):

	num = 65

	for i in range(0, n):
	
		for j in range(0, i+1):

			ch = chr(num)
		
			print(ch, end=" ")
	
		num = num + 1
	
		print("\r")

n = 5
alphapat(n)

```